Products 1260854-98-5
CAS 1260854-98-5 appears in our catalog under these names: 3–Methoxy–N–methyl–5–(trifluoromethyl)aniline, 3-Methoxy-n-methyl-5-(trifluoromethyl)aniline, 95%. Offered by: GLPBio, Combi-blocks. Available pack sizes: 100mg, 250mg, 1g, 5g.
3-methoxy-N-methyl-5-(trifluoromethyl)aniline (CAS 1260854-98-5) is a chemical compound with the molecular formula C9H10F3NO and a molecular weight of 205.18 g/mol. IUPAC name: 3-methoxy-N-methyl-5-(trifluoromethyl)aniline. InChIKey: FRHVQFZGEMKTMG-UHFFFAOYSA-N.
| Molecular formula | C9H10F3NO |
|---|---|
| Molecular weight | 205.18 g/mol |
| IUPAC name | 3-methoxy-N-methyl-5-(trifluoromethyl)aniline |
| InChIKey | FRHVQFZGEMKTMG-UHFFFAOYSA-N |
| SMILES | CNC1=CC(=CC(=C1)C(F)(F)F)OC |
Computed by PubChem (NCBI)