cas: 608141-43-1 — see every product listed under this CAS number, including other names
(S)-1-(3-Ethoxy-4-methoxyphenyl)-2-(methylsulfonyl)ethanamine (S)-2-acetamido-4-methylpentanoate, 97%, 97% (CAS 608141-43-1) is a chemical reagent available from Chemat. Available pack sizes: 10g, 1kg, 1g, 5g, 25g, 100g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IAR9-10g |
| cas | 608141-43-1 |
| size | 10g |
| availability | 9000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 261.20 Pln | |
| Chemat | 1kg | 6386.00 Pln | |
| Chemat | 1g | 88.40 Pln | |
| Chemat | 5g | 165.20 Pln | |
| Chemat | 25g | 410.00 Pln | |
| Chemat | 100g | 1245.20 Pln | |
| Chemat | 500g | 3912.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(2S)-2-acetamido-4-methylpentanoic acid;(1S)-1-(3-ethoxy-4-methoxyphenyl)-2-methylsulfonylethanamine (CAS 608141-43-1) is a chemical compound with the molecular formula C20H34N2O7S and a molecular weight of 446.6 g/mol. IUPAC name: (2S)-2-acetamido-4-methylpentanoic acid;(1S)-1-(3-ethoxy-4-methoxyphenyl)-2-methylsulfonylethanamine. InChIKey: KJZXYHPZWRDLAR-JIJBYVMQSA-N.
| Molecular formula | C20H34N2O7S |
|---|---|
| Molecular weight | 446.6 g/mol |
| IUPAC name | (2S)-2-acetamido-4-methylpentanoic acid;(1S)-1-(3-ethoxy-4-methoxyphenyl)-2-methylsulfonylethanamine |
| InChIKey | KJZXYHPZWRDLAR-JIJBYVMQSA-N |
| SMILES | CCOC1=C(C=CC(=C1)[C@@H](CS(=O)(=O)C)N)OC.CC(C)C[C@@H](C(=O)O)NC(=O)C |
Computed by PubChem (NCBI)