(S)-1-(3-Ethoxy-4-methoxyphenyl)-2-(methylsulfonyl)ethylamine N-acetyl-L-leucine, 99.99%
cas: 608141-43-1 — see every product listed under this CAS number, including other names
(S)-1-(3-Ethoxy-4-methoxyphenyl)-2-(methylsulfonyl)ethylamine N-acetyl-L-leucine, 99.99% (CAS 608141-43-1) is a chemical reagent available from Chemat. Available pack sizes: 25 g, 1 g, 10 g, 5 g, 100 g, 1 kg, 50 g, 500 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-I0616A-25 g |
| cas | 608141-43-1 |
| size | 25 g |
| availability | In stock |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 25 g | 839.82 Pln | |
| MedChemExpress | 1 g | 240.74 Pln | |
| MedChemExpress | 10 g | 505.45 Pln | |
| MedChemExpress | 5 g | 361.49 Pln | |
| MedChemExpress | 100 g | 1917.23 Pln | |
| MedChemExpress | 1 kg | 8757.84 Pln | |
| MedChemExpress | 50 g | 1248.49 Pln | |
| MedChemExpress | 500 g | 5516.33 Pln |
properties
| delivery time | 2-3 weeks |
|---|---|
| purity | 99.99% |
(2S)-2-acetamido-4-methylpentanoic acid;(1S)-1-(3-ethoxy-4-methoxyphenyl)-2-methylsulfonylethanamine (CAS 608141-43-1) is a chemical compound with the molecular formula C20H34N2O7S and a molecular weight of 446.6 g/mol. IUPAC name: (2S)-2-acetamido-4-methylpentanoic acid;(1S)-1-(3-ethoxy-4-methoxyphenyl)-2-methylsulfonylethanamine. InChIKey: KJZXYHPZWRDLAR-JIJBYVMQSA-N.
| Molecular formula | C20H34N2O7S |
|---|---|
| Molecular weight | 446.6 g/mol |
| IUPAC name | (2S)-2-acetamido-4-methylpentanoic acid;(1S)-1-(3-ethoxy-4-methoxyphenyl)-2-methylsulfonylethanamine |
| InChIKey | KJZXYHPZWRDLAR-JIJBYVMQSA-N |
| SMILES | CCOC1=C(C=CC(=C1)[C@@H](CS(=O)(=O)C)N)OC.CC(C)C[C@@H](C(=O)O)NC(=O)C |
Computed by PubChem (NCBI)
Synonyms:
orb3144370, KJZXYHPZWRDLAR-JIJBYVMQSA-N