cas: 608141-43-1 — see every product listed under this CAS number, including other names
(S)-1-(3-Ethoxy-4-methoxyphenyl)-2-(methylsulfonyl)ethylamine N-acetyl-L-leucine salt, 98% (CAS 608141-43-1) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F789909-5G |
| cas | 608141-43-1 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 284.29 Pln | |
| Fluorochem | 10g | 419.66 Pln | |
| Fluorochem | 25g | 633.13 Pln | |
| Fluorochem | 100g | 1580.71 Pln | |
| Fluorochem | 500g | 4938.90 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
(2S)-2-acetamido-4-methylpentanoic acid;(1S)-1-(3-ethoxy-4-methoxyphenyl)-2-methylsulfonylethanamine (CAS 608141-43-1) is a chemical compound with the molecular formula C20H34N2O7S and a molecular weight of 446.6 g/mol. IUPAC name: (2S)-2-acetamido-4-methylpentanoic acid;(1S)-1-(3-ethoxy-4-methoxyphenyl)-2-methylsulfonylethanamine. InChIKey: KJZXYHPZWRDLAR-JIJBYVMQSA-N.
| Molecular formula | C20H34N2O7S |
|---|---|
| Molecular weight | 446.6 g/mol |
| IUPAC name | (2S)-2-acetamido-4-methylpentanoic acid;(1S)-1-(3-ethoxy-4-methoxyphenyl)-2-methylsulfonylethanamine |
| InChIKey | KJZXYHPZWRDLAR-JIJBYVMQSA-N |
| SMILES | CCOC1=C(C=CC(=C1)[C@@H](CS(=O)(=O)C)N)OC.CC(C)C[C@@H](C(=O)O)NC(=O)C |
Computed by PubChem (NCBI)