cas: 608141-43-1 — see every product listed under this CAS number, including other names
(S)-2-(3-ethoxy-4-methoxyphenyl)-1-(methylsulphonyl)-eth-2-ylamine N-acetyl-L-leucine salt 97% (CAS 608141-43-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A142160-1g |
| cas | 608141-43-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 125.62 Pln | |
| Ambeed | 5g | 292.50 Pln | |
| Ambeed | 25g | 565.06 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A142160 |
(2S)-2-acetamido-4-methylpentanoic acid;(1S)-1-(3-ethoxy-4-methoxyphenyl)-2-methylsulfonylethanamine (CAS 608141-43-1) is a chemical compound with the molecular formula C20H34N2O7S and a molecular weight of 446.6 g/mol. IUPAC name: (2S)-2-acetamido-4-methylpentanoic acid;(1S)-1-(3-ethoxy-4-methoxyphenyl)-2-methylsulfonylethanamine. InChIKey: KJZXYHPZWRDLAR-JIJBYVMQSA-N.
| Molecular formula | C20H34N2O7S |
|---|---|
| Molecular weight | 446.6 g/mol |
| IUPAC name | (2S)-2-acetamido-4-methylpentanoic acid;(1S)-1-(3-ethoxy-4-methoxyphenyl)-2-methylsulfonylethanamine |
| InChIKey | KJZXYHPZWRDLAR-JIJBYVMQSA-N |
| SMILES | CCOC1=C(C=CC(=C1)[C@@H](CS(=O)(=O)C)N)OC.CC(C)C[C@@H](C(=O)O)NC(=O)C |
Computed by PubChem (NCBI)