cas: 951247-75-9 — see every product listed under this CAS number, including other names
(S)-1-(4-(Trifluoromethoxy)phenyl)ethanamine, 99.37% (CAS 951247-75-9) is a chemical reagent available from Chemat. Available pack sizes: 5 g, 250 mg, 100 mg, 500 mg, 1 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-30440-5 g |
| cas | 951247-75-9 |
| size | 5 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 5 g | 3022.50 Pln | |
| MedChemExpress | 250 mg | 477.59 Pln | |
| MedChemExpress | 100 mg | 319.69 Pln | |
| MedChemExpress | 500 mg | 686.57 Pln | |
| MedChemExpress | 1 g | 1020.94 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 99.37% |
(1S)-1-[4-(trifluoromethoxy)phenyl]ethanamine (CAS 951247-75-9) is a chemical compound with the molecular formula C9H10F3NO and a molecular weight of 205.18 g/mol. IUPAC name: (1S)-1-[4-(trifluoromethoxy)phenyl]ethanamine. InChIKey: VTLIABOHZPSHRN-LURJTMIESA-N.
| Molecular formula | C9H10F3NO |
|---|---|
| Molecular weight | 205.18 g/mol |
| IUPAC name | (1S)-1-[4-(trifluoromethoxy)phenyl]ethanamine |
| InChIKey | VTLIABOHZPSHRN-LURJTMIESA-N |
| SMILES | C[C@@H](C1=CC=C(C=C1)OC(F)(F)F)N |
Computed by PubChem (NCBI)