cas: 1001353-87-2 — see every product listed under this CAS number, including other names
(S)-1-(tert-Butoxycarbonyl)-4,4-dimethylpyrrolidine-2-carboxylic acid, 95% (CAS 1001353-87-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 250mg, 5g, 100mg, 500mg, 10g, 25g. Offered by: Combi-blocks, Fluorochem.
| brand | Combi-blocks |
|---|---|
| catalog number | OR-9233-1g |
| cas | 1001353-87-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 1g | price on request | |
| Combi-blocks | 250mg | price on request | |
| Combi-blocks | 5g | price on request | |
| Combi-blocks | 100mg | price on request | |
| Fluorochem | 100mg | 237.43 Pln | |
| Fluorochem | 250mg | 357.18 Pln | |
| Fluorochem | 500mg | 664.37 Pln | |
| Fluorochem | 1g | 1112.13 Pln | |
| Fluorochem | 5g | 4074.62 Pln | |
| Fluorochem | 10g | 8099.25 Pln | |
| Fluorochem | 25g | 20167.92 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
(2S)-4,4-dimethyl-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid (CAS 1001353-87-2) is a chemical compound with the molecular formula C12H21NO4 and a molecular weight of 243.30 g/mol. IUPAC name: (2S)-4,4-dimethyl-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid. InChIKey: ACHKRIQLSCPKKK-QMMMGPOBSA-N.
| Molecular formula | C12H21NO4 |
|---|---|
| Molecular weight | 243.30 g/mol |
| IUPAC name | (2S)-4,4-dimethyl-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid |
| InChIKey | ACHKRIQLSCPKKK-QMMMGPOBSA-N |
| SMILES | CC1(C[C@H](N(C1)C(=O)OC(C)(C)C)C(=O)O)C |
Computed by PubChem (NCBI)