cas: 1001353-87-2 — see every product listed under this CAS number, including other names
(S)-1-(tert-butoxycarbonyl)-4,4-dimethylpyrrolidine-2-carboxylic acid, 97%, 97% (CAS 1001353-87-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11122V-100mg |
| cas | 1001353-87-2 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 160.40 Pln | |
| Chemat | 250mg | 232.40 Pln | |
| Chemat | 1g | 741.20 Pln | |
| Chemat | 5g | 3170.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(2S)-4,4-dimethyl-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid (CAS 1001353-87-2) is a chemical compound with the molecular formula C12H21NO4 and a molecular weight of 243.30 g/mol. IUPAC name: (2S)-4,4-dimethyl-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid. InChIKey: ACHKRIQLSCPKKK-QMMMGPOBSA-N.
| Molecular formula | C12H21NO4 |
|---|---|
| Molecular weight | 243.30 g/mol |
| IUPAC name | (2S)-4,4-dimethyl-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid |
| InChIKey | ACHKRIQLSCPKKK-QMMMGPOBSA-N |
| SMILES | CC1(C[C@H](N(C1)C(=O)OC(C)(C)C)C(=O)O)C |
Computed by PubChem (NCBI)