cas: 1353006-46-8 — see every product listed under this CAS number, including other names
(S)-1-Boc-3-Methylpiperazine hydrochloride, 95%, 95% (CAS 1353006-46-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HU1R-1g |
| cas | 1353006-46-8 |
| size | 1g |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 98.00 Pln | |
| Chemat | 25g | 237.20 Pln | |
| Chemat | 100g | 760.40 Pln | |
| Chemat | 10g | 131.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl (3S)-3-methylpiperazine-1-carboxylate;hydrochloride (CAS 1353006-46-8) is a chemical compound with the molecular formula C10H21ClN2O2 and a molecular weight of 236.74 g/mol. IUPAC name: tert-butyl (3S)-3-methylpiperazine-1-carboxylate;hydrochloride. InChIKey: SYNMIMWDYFYCCC-QRPNPIFTSA-N.
| Molecular formula | C10H21ClN2O2 |
|---|---|
| Molecular weight | 236.74 g/mol |
| IUPAC name | tert-butyl (3S)-3-methylpiperazine-1-carboxylate;hydrochloride |
| InChIKey | SYNMIMWDYFYCCC-QRPNPIFTSA-N |
| SMILES | C[C@H]1CN(CCN1)C(=O)OC(C)(C)C.Cl |
Computed by PubChem (NCBI)