cas: 155905-76-3 — see every product listed under this CAS number, including other names
(S)-1-Boc-azepane-2-carboxylic acid 98% (CAS 155905-76-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A245776-100mg |
| cas | 155905-76-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 576.19 Pln | |
| Ambeed | 250mg | 926.62 Pln | |
| Ambeed | 1g | 1499.56 Pln | |
| Ambeed | 5g | 5076.25 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A245776 |
(2S)-1-[(2-methylpropan-2-yl)oxycarbonyl]azepane-2-carboxylic acid (CAS 155905-76-3) is a chemical compound with the molecular formula C12H21NO4 and a molecular weight of 243.30 g/mol. IUPAC name: (2S)-1-[(2-methylpropan-2-yl)oxycarbonyl]azepane-2-carboxylic acid. InChIKey: BKMVFOKQLCHCPK-VIFPVBQESA-N.
| Molecular formula | C12H21NO4 |
|---|---|
| Molecular weight | 243.30 g/mol |
| IUPAC name | (2S)-1-[(2-methylpropan-2-yl)oxycarbonyl]azepane-2-carboxylic acid |
| InChIKey | BKMVFOKQLCHCPK-VIFPVBQESA-N |
| SMILES | CC(C)(C)OC(=O)N1CCCCC[C@H]1C(=O)O |
Computed by PubChem (NCBI)