cas: 155905-76-3 — see every product listed under this CAS number, including other names
(S)-1-Boc-azepane-2-carboxylic acid, 97%, 97% (CAS 155905-76-3) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 500mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112OCC-25mg |
| cas | 155905-76-3 |
| size | 25mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 25mg | 98.00 Pln | |
| Chemat | 500mg | 909.20 Pln | |
| Chemat | 1g | 1058.00 Pln | |
| Chemat | 5g | 4874.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(2S)-1-[(2-methylpropan-2-yl)oxycarbonyl]azepane-2-carboxylic acid (CAS 155905-76-3) is a chemical compound with the molecular formula C12H21NO4 and a molecular weight of 243.30 g/mol. IUPAC name: (2S)-1-[(2-methylpropan-2-yl)oxycarbonyl]azepane-2-carboxylic acid. InChIKey: BKMVFOKQLCHCPK-VIFPVBQESA-N.
| Molecular formula | C12H21NO4 |
|---|---|
| Molecular weight | 243.30 g/mol |
| IUPAC name | (2S)-1-[(2-methylpropan-2-yl)oxycarbonyl]azepane-2-carboxylic acid |
| InChIKey | BKMVFOKQLCHCPK-VIFPVBQESA-N |
| SMILES | CC(C)(C)OC(=O)N1CCCCC[C@H]1C(=O)O |
Computed by PubChem (NCBI)