cas: 78058-41-0 — see every product listed under this CAS number, including other names
(S)-1-N-BOC-PIPERIDINE-2-CARBOXAMIDE, 97%, 97% (CAS 78058-41-0) is a chemical reagent available from Chemat. Available pack sizes: 5g, 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch116DOP-5g |
| cas | 78058-41-0 |
| size | 5g |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 1586.00 Pln | |
| Chemat | 100mg | 150.80 Pln | |
| Chemat | 250mg | 213.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl (2S)-2-carbamoylpiperidine-1-carboxylate (CAS 78058-41-0) is a chemical compound with the molecular formula C11H20N2O3 and a molecular weight of 228.29 g/mol. IUPAC name: tert-butyl (2S)-2-carbamoylpiperidine-1-carboxylate. InChIKey: KIFYKONQFFJILQ-QMMMGPOBSA-N.
| Molecular formula | C11H20N2O3 |
|---|---|
| Molecular weight | 228.29 g/mol |
| IUPAC name | tert-butyl (2S)-2-carbamoylpiperidine-1-carboxylate |
| InChIKey | KIFYKONQFFJILQ-QMMMGPOBSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCCC[C@H]1C(=O)N |
Computed by PubChem (NCBI)