Products 1824802-59-6
CAS 1824802-59-6 is the registry number for N-Boc-hexahydro-1h-azepin-4-one oxime, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
Tert-butyl (4E)-4-hydroxyiminoazepane-1-carboxylate (CAS 1824802-59-6) is a chemical compound with the molecular formula C11H20N2O3 and a molecular weight of 228.29 g/mol. IUPAC name: tert-butyl (4E)-4-hydroxyiminoazepane-1-carboxylate. InChIKey: DZQMYHIZHPBIPL-FMIVXFBMSA-N.
| Molecular formula | C11H20N2O3 |
|---|---|
| Molecular weight | 228.29 g/mol |
| IUPAC name | tert-butyl (4E)-4-hydroxyiminoazepane-1-carboxylate |
| InChIKey | DZQMYHIZHPBIPL-FMIVXFBMSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC/C(=N\O)/CC1 |
Computed by PubChem (NCBI)