cas: 118864-75-8 — see every product listed under this CAS number, including other names
(S)-1-Phenyl-1,2,3,4-Tetrahydroisoquinoline, 98%, 98% (CAS 118864-75-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 50g, 250g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1191T2-1g |
| cas | 118864-75-8 |
| size | 1g |
| availability | 2000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 83.60 Pln | |
| Chemat | 10g | 98.00 Pln | |
| Chemat | 25g | 136.40 Pln | |
| Chemat | 100g | 309.20 Pln | |
| Chemat | 50g | 208.40 Pln | |
| Chemat | 250g | 674.00 Pln | |
| Chemat | 500g | 1339.20 Pln | |
| Chemat | 1kg | 2526.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(1S)-1-phenyl-1,2,3,4-tetrahydroisoquinoline (CAS 118864-75-8) is a chemical compound with the molecular formula C15H15N and a molecular weight of 209.29 g/mol. IUPAC name: (1S)-1-phenyl-1,2,3,4-tetrahydroisoquinoline. InChIKey: PRTRSEDVLBBFJZ-HNNXBMFYSA-N.
| Molecular formula | C15H15N |
|---|---|
| Molecular weight | 209.29 g/mol |
| IUPAC name | (1S)-1-phenyl-1,2,3,4-tetrahydroisoquinoline |
| InChIKey | PRTRSEDVLBBFJZ-HNNXBMFYSA-N |
| SMILES | C1CN[C@H](C2=CC=CC=C21)C3=CC=CC=C3 |
Computed by PubChem (NCBI)