CAS 78787-83-4 appears in our catalog under these names: 1,4,8-Trimethyl-9h-carbazole, 95%, 1,5,8–TriMethylcarbazole, 1,4,8-Trimethyl-9H-carbazole, 97%. Offered by: Combi-blocks, GLPBio, Ambeed. Available pack sizes: 250mg, 1g, 100mg, 50mg.
1,4,8-trimethyl-9H-carbazole (CAS 78787-83-4) is a chemical compound with the molecular formula C15H15N and a molecular weight of 209.29 g/mol. IUPAC name: 1,4,8-trimethyl-9H-carbazole. InChIKey: DKMJSUBUAMUZAJ-UHFFFAOYSA-N.
| Molecular formula | C15H15N |
|---|---|
| Molecular weight | 209.29 g/mol |
| IUPAC name | 1,4,8-trimethyl-9H-carbazole |
| InChIKey | DKMJSUBUAMUZAJ-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=CC=C1)C3=C(C=CC(=C3N2)C)C |
Computed by PubChem (NCBI)