Products 6037-73-6

CAS 6037-73-6 is the registry number for 1-Benzyl-2,3-dihydro-1h-indole, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

1-benzyl-2,3-dihydroindole (CAS 6037-73-6) is a chemical compound with the molecular formula C15H15N and a molecular weight of 209.29 g/mol. IUPAC name: 1-benzyl-2,3-dihydroindole. InChIKey: SBWJGPICKZXXOG-UHFFFAOYSA-N.

Identity
Molecular formulaC15H15N
Molecular weight209.29 g/mol
IUPAC name1-benzyl-2,3-dihydroindole
InChIKeySBWJGPICKZXXOG-UHFFFAOYSA-N
SMILESC1CN(C2=CC=CC=C21)CC3=CC=CC=C3

Computed by PubChem (NCBI)