CAS 180272-45-1 appears in our catalog under these names: (1R)-1-Phenyl-1,2,3,4-tetrahydroisoquinoline, (R)-1-Phenyl-1,2,3,4-tetrahydroisoquinoline, (1R)-1-Phenyl-1,2,3,4-tetrahydroisoquinoline, 98%, (R)-1-Phenyl-1,2,3,4-tetrahydroisoquinoline, >95% (HPLC), (1R)-1-Phenyl-1,2,3,4-tetrahydroisoquinoline, 98%, 98%. Offered by: Mikromol, Biosynth, Fluorochem, Ambeed, TRC. Available pack sizes: 4x25mg, 25mg, 2500mg, 1000mg, 5000mg, 10000mg, 100mg, 250mg.
(1R)-1-phenyl-1,2,3,4-tetrahydroisoquinoline (CAS 180272-45-1) is a chemical compound with the molecular formula C15H15N and a molecular weight of 209.29 g/mol. IUPAC name: (1R)-1-phenyl-1,2,3,4-tetrahydroisoquinoline. InChIKey: PRTRSEDVLBBFJZ-OAHLLOKOSA-N.
| Molecular formula | C15H15N |
|---|---|
| Molecular weight | 209.29 g/mol |
| IUPAC name | (1R)-1-phenyl-1,2,3,4-tetrahydroisoquinoline |
| InChIKey | PRTRSEDVLBBFJZ-OAHLLOKOSA-N |
| SMILES | C1CN[C@@H](C2=CC=CC=C21)C3=CC=CC=C3 |
Computed by PubChem (NCBI)