cas: 74844-93-2 — see every product listed under this CAS number, including other names
(S)-1-tert-Butyl 2-methyl 1H-pyrrole-1,2(2H,5H)-dicarboxylate, 98%, 98% (CAS 74844-93-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 50g, 100g, 250g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11G3X8-250mg |
| cas | 74844-93-2 |
| size | 250mg |
| availability | 25000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 74.00 Pln | |
| Chemat | 1g | 83.60 Pln | |
| Chemat | 5g | 117.20 Pln | |
| Chemat | 10g | 146.00 Pln | |
| Chemat | 25g | 232.40 Pln | |
| Chemat | 50g | 357.20 Pln | |
| Chemat | 100g | 544.40 Pln | |
| Chemat | 250g | 1029.20 Pln | |
| Chemat | 500g | 1579.20 Pln | |
| Chemat | 1kg | 2939.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1-O-tert-butyl 2-O-methyl (2S)-2,5-dihydropyrrole-1,2-dicarboxylate (CAS 74844-93-2) is a chemical compound with the molecular formula C11H17NO4 and a molecular weight of 227.26 g/mol. IUPAC name: 1-O-tert-butyl 2-O-methyl (2S)-2,5-dihydropyrrole-1,2-dicarboxylate. InChIKey: YDQDZLXTPXNOKO-QMMMGPOBSA-N.
| Molecular formula | C11H17NO4 |
|---|---|
| Molecular weight | 227.26 g/mol |
| IUPAC name | 1-O-tert-butyl 2-O-methyl (2S)-2,5-dihydropyrrole-1,2-dicarboxylate |
| InChIKey | YDQDZLXTPXNOKO-QMMMGPOBSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC=C[C@H]1C(=O)OC |
Computed by PubChem (NCBI)