CAS 202477-57-4 appears in our catalog under these names: 1-tert-butyl 2-methyl 2,5-dihydro-1h-pyrrole-1,2-dicarboxylate, 95%, 1–tert–butyl 2–methyl 1H–pyrrole–1,2(2H,5H)–dicarboxylate, 1-tert-Butyl 2-methyl 2,5-dihydro-1H-pyrrole-1,2-dicarboxylate, 1-tert-Butyl 2-methyl 2,5-dihydro-1H-pyrrole-1,2-dicarboxylate 97%, 1-tert-butyl 2-methyl 2,5-dihydro-1H-pyrrole-1,2-dicarboxylate, 97%, 97%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 5g, 10g, 250mg, 100mg, 1g, 0,5g.
1-O-tert-butyl 2-O-methyl 2,5-dihydropyrrole-1,2-dicarboxylate (CAS 202477-57-4) is a chemical compound with the molecular formula C11H17NO4 and a molecular weight of 227.26 g/mol. IUPAC name: 1-O-tert-butyl 2-O-methyl 2,5-dihydropyrrole-1,2-dicarboxylate. InChIKey: YDQDZLXTPXNOKO-UHFFFAOYSA-N.
| Molecular formula | C11H17NO4 |
|---|---|
| Molecular weight | 227.26 g/mol |
| IUPAC name | 1-O-tert-butyl 2-O-methyl 2,5-dihydropyrrole-1,2-dicarboxylate |
| InChIKey | YDQDZLXTPXNOKO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC=CC1C(=O)OC |
Computed by PubChem (NCBI)