cas: 88466-76-6 — see every product listed under this CAS number, including other names
(S)-1-tert-Butyl 3-methyl piperidine-1,3-dicarboxylate, 97% (CAS 88466-76-6) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F465232-5G |
| cas | 88466-76-6 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 284.29 Pln | |
| Fluorochem | 10g | 513.38 Pln | |
| Fluorochem | 25g | 1200.64 Pln | |
| Fluorochem | 100g | 4501.56 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
1-O-tert-butyl 3-O-methyl (3S)-piperidine-1,3-dicarboxylate (CAS 88466-76-6) is a chemical compound with the molecular formula C12H21NO4 and a molecular weight of 243.30 g/mol. IUPAC name: 1-O-tert-butyl 3-O-methyl (3S)-piperidine-1,3-dicarboxylate. InChIKey: LYYJQMCPEHXOEW-VIFPVBQESA-N.
| Molecular formula | C12H21NO4 |
|---|---|
| Molecular weight | 243.30 g/mol |
| IUPAC name | 1-O-tert-butyl 3-O-methyl (3S)-piperidine-1,3-dicarboxylate |
| InChIKey | LYYJQMCPEHXOEW-VIFPVBQESA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@@H](C1)C(=O)OC |
Computed by PubChem (NCBI)