CAS 88466-76-6 appears in our catalog under these names: Methyl N-BOC-(S)-piperidine-3-carboxylate, 97%, (S)-1-tert-Butyl 3-methyl piperidine-1,3-dicarboxylate 95%, (S)-1-tert-Butyl 3-methyl piperidine-1,3-dicarboxylate, 97%, 97%, (S)-1-tert-Butyl 3-methyl piperidine-1,3-dicarboxylate, 97%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 100g, 5g, 1g, 100mg, 250mg, 10g.
1-O-tert-butyl 3-O-methyl (3S)-piperidine-1,3-dicarboxylate (CAS 88466-76-6) is a chemical compound with the molecular formula C12H21NO4 and a molecular weight of 243.30 g/mol. IUPAC name: 1-O-tert-butyl 3-O-methyl (3S)-piperidine-1,3-dicarboxylate. InChIKey: LYYJQMCPEHXOEW-VIFPVBQESA-N.
| Molecular formula | C12H21NO4 |
|---|---|
| Molecular weight | 243.30 g/mol |
| IUPAC name | 1-O-tert-butyl 3-O-methyl (3S)-piperidine-1,3-dicarboxylate |
| InChIKey | LYYJQMCPEHXOEW-VIFPVBQESA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@@H](C1)C(=O)OC |
Computed by PubChem (NCBI)