cas: 82717-96-2 — see every product listed under this CAS number, including other names
(S)-2-(((S)-1-Ethoxy-1-oxo-4-phenylbutan-2-yl)amino)propanoic acid, 98% (CAS 82717-96-2) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F079849-25G |
| cas | 82717-96-2 |
| size | 25g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 25g | 122.89 Pln | |
| Fluorochem | 100g | 216.61 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
(2S)-2-[[(2S)-1-ethoxy-1-oxo-4-phenylbutan-2-yl]amino]propanoic acid (CAS 82717-96-2) is a chemical compound with the molecular formula C15H21NO4 and a molecular weight of 279.33 g/mol. IUPAC name: (2S)-2-[[(2S)-1-ethoxy-1-oxo-4-phenylbutan-2-yl]amino]propanoic acid. InChIKey: CEIWXEQZZZHLDM-AAEUAGOBSA-N.
| Molecular formula | C15H21NO4 |
|---|---|
| Molecular weight | 279.33 g/mol |
| IUPAC name | (2S)-2-[[(2S)-1-ethoxy-1-oxo-4-phenylbutan-2-yl]amino]propanoic acid |
| InChIKey | CEIWXEQZZZHLDM-AAEUAGOBSA-N |
| SMILES | CCOC(=O)[C@H](CCC1=CC=CC=C1)N[C@@H](C)C(=O)O |
Computed by PubChem (NCBI)