CAS 82717-96-2 appears in our catalog under these names: (S)-2-(((S)-1-Ethoxy-1-oxo-4-phenylbutan-2-yl)amino)propanoic acid, 99.74%, (S)-2-(((S)-1-Ethoxy-1-oxo-4-phenylbutan-2-yl)amino)propanoic acid (Standard), (S)-2-(((S)-1-Ethoxy-1-oxo-4-phenylbutan-2-yl)amino)propanoic acid, 98%, (S)-2-(((S)-1-Ethoxy-1-oxo-4-phenylbutan-2-yl)amino)propanoic acid, 98%, 98%, N-[(S)-(+)-1-(Ethoxycarbonyl)-3-phenylpropyl]-l-alanine, 98%. Offered by: MedChemExpress, Fluorochem, Chemat, Combi-blocks, Chemat Brand. Available pack sizes: 100 g, 500 g, 50 mg, 250 mg, 100 mg, 25 mg, 25g, 100g.
(2S)-2-[[(2S)-1-ethoxy-1-oxo-4-phenylbutan-2-yl]amino]propanoic acid (CAS 82717-96-2) is a chemical compound with the molecular formula C15H21NO4 and a molecular weight of 279.33 g/mol. IUPAC name: (2S)-2-[[(2S)-1-ethoxy-1-oxo-4-phenylbutan-2-yl]amino]propanoic acid. InChIKey: CEIWXEQZZZHLDM-AAEUAGOBSA-N.
| Molecular formula | C15H21NO4 |
|---|---|
| Molecular weight | 279.33 g/mol |
| IUPAC name | (2S)-2-[[(2S)-1-ethoxy-1-oxo-4-phenylbutan-2-yl]amino]propanoic acid |
| InChIKey | CEIWXEQZZZHLDM-AAEUAGOBSA-N |
| SMILES | CCOC(=O)[C@H](CCC1=CC=CC=C1)N[C@@H](C)C(=O)O |
Computed by PubChem (NCBI)