(S)-2-((S)-2,5-Diaminopentanamido)succinic acid, 95%, 95%
cas: 7327-72-2 — see every product listed under this CAS number, including other names
(S)-2-((S)-2,5-Diaminopentanamido)succinic acid, 95%, 95% (CAS 7327-72-2) is a chemical reagent available from Chemat. Available pack sizes: 10mg, 5mg, 25mg, 50mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch116F9D-10mg |
| cas | 7327-72-2 |
| size | 10mg |
| availability | 0.1g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 10mg | 405.20 Pln | |
| Chemat | 5mg | 270.80 Pln | |
| Chemat | 25mg | 544.40 Pln | |
| Chemat | 50mg | 750.80 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(2S)-2-[[(2S)-2,5-diaminopentanoyl]amino]butanedioic acid (CAS 7327-72-2) is a chemical compound with the molecular formula C9H17N3O5 and a molecular weight of 247.25 g/mol. IUPAC name: (2S)-2-[[(2S)-2,5-diaminopentanoyl]amino]butanedioic acid. InChIKey: KCOLRAYANGZVFU-WDSKDSINSA-N.
| Molecular formula | C9H17N3O5 |
|---|---|
| Molecular weight | 247.25 g/mol |
| IUPAC name | (2S)-2-[[(2S)-2,5-diaminopentanoyl]amino]butanedioic acid |
| InChIKey | KCOLRAYANGZVFU-WDSKDSINSA-N |
| SMILES | C(C[C@@H](C(=O)N[C@@H](CC(=O)O)C(=O)O)N)CN |
Computed by PubChem (NCBI)
Synonyms:
L-Aspartic acid, N-L-ornithyl-, (S)-2-((S)-2,5-Diaminopentanamido)succinic acid, (2S)-2-[[(2S)-2,5-diaminopentanoyl]amino]butanedioic acid, Ornithine Impurity 11, L-Ornithyl-L-aspartic acid, L-Ornithine L-Aspartate Impurity 3, ((S)-2,5-diaminopentanoyl)-L-aspartic acid(Discontinued,See C4X-25363)