CAS 886996-37-8 appears in our catalog under these names: Ornithine Impurity 4, α-Aspartic acid-δ-ornithine Dimer. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-2-amino-5-[[(2S)-2-amino-3-carboxypropanoyl]amino]pentanoic acid (CAS 886996-37-8) is a chemical compound with the molecular formula C9H17N3O5 and a molecular weight of 247.25 g/mol. IUPAC name: (2S)-2-amino-5-[[(2S)-2-amino-3-carboxypropanoyl]amino]pentanoic acid. InChIKey: RXZOEFJDAUMUEZ-WDSKDSINSA-N.
| Molecular formula | C9H17N3O5 |
|---|---|
| Molecular weight | 247.25 g/mol |
| IUPAC name | (2S)-2-amino-5-[[(2S)-2-amino-3-carboxypropanoyl]amino]pentanoic acid |
| InChIKey | RXZOEFJDAUMUEZ-WDSKDSINSA-N |
| SMILES | C(C[C@@H](C(=O)O)N)CNC(=O)[C@H](CC(=O)O)N |
Computed by PubChem (NCBI)