Products 1174925-92-8

CAS 1174925-92-8 is the registry number for Ornithine Impurity 10. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

(2S)-5-amino-2-[[(3S)-3-amino-3-carboxypropanoyl]amino]pentanoic acid (CAS 1174925-92-8) is a chemical compound with the molecular formula C9H17N3O5 and a molecular weight of 247.25 g/mol. IUPAC name: (2S)-5-amino-2-[[(3S)-3-amino-3-carboxypropanoyl]amino]pentanoic acid. InChIKey: ATFQKXOOPOLRNP-WDSKDSINSA-N.

Identity
Molecular formulaC9H17N3O5
Molecular weight247.25 g/mol
IUPAC name(2S)-5-amino-2-[[(3S)-3-amino-3-carboxypropanoyl]amino]pentanoic acid
InChIKeyATFQKXOOPOLRNP-WDSKDSINSA-N
SMILESC(C[C@@H](C(=O)O)NC(=O)C[C@@H](C(=O)O)N)CN

Computed by PubChem (NCBI)