cas: 3303-31-9 — see every product listed under this CAS number, including other names
(S)-2-((S)-2-Amino-4-methylpentanamido)-4-methylpentanoic acid, 95%, 95% (CAS 3303-31-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BY0X-250mg |
| cas | 3303-31-9 |
| size | 250mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 93.20 Pln | |
| Chemat | 1g | 107.60 Pln | |
| Chemat | 5g | 270.80 Pln | |
| Chemat | 10g | 438.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Leu-Leu is a dipeptide formed from two L-leucine residues. It has a role as a Mycoplasma genitalium metabolite and a human metabolite. It is functionally related to a L-leucine. It is a tautomer of a Leu-Leu zwitterion.
Source: ChEBI
| Molecular formula | C12H24N2O3 |
|---|---|
| Molecular weight | 244.33 g/mol |
| IUPAC name | (2S)-2-[[(2S)-2-amino-4-methylpentanoyl]amino]-4-methylpentanoic acid |
| InChIKey | LCPYQJIKPJDLLB-UWVGGRQHSA-N |
| SMILES | CC(C)C[C@@H](C(=O)N[C@@H](CC(C)C)C(=O)O)N |
Computed by PubChem (NCBI)