CAS 38689-31-5 appears in our catalog under these names: H–D–Leu–Leu–OH, H-D-Leu-leu-oh, 95%, H-D-Leu-L-Leu-OH, >95% (HPLC), (S)-2-((R)-2-Amino-4-methylpentanamido)-4-methylpentanoic acid, 97%, H-D-Leu-Leu-OH 95%. Offered by: GLPBio, Combi-blocks, TRC, AmBeed, Chemat. Available pack sizes: 5g, 250mg, 1g, 25mg, 100mg.
(2S)-2-[[(2R)-2-amino-4-methylpentanoyl]amino]-4-methylpentanoic acid (CAS 38689-31-5) is a chemical compound with the molecular formula C12H24N2O3 and a molecular weight of 244.33 g/mol. IUPAC name: (2S)-2-[[(2R)-2-amino-4-methylpentanoyl]amino]-4-methylpentanoic acid. InChIKey: LCPYQJIKPJDLLB-ZJUUUORDSA-N.
| Molecular formula | C12H24N2O3 |
|---|---|
| Molecular weight | 244.33 g/mol |
| IUPAC name | (2S)-2-[[(2R)-2-amino-4-methylpentanoyl]amino]-4-methylpentanoic acid |
| InChIKey | LCPYQJIKPJDLLB-ZJUUUORDSA-N |
| SMILES | CC(C)C[C@H](C(=O)N[C@@H](CC(C)C)C(=O)O)N |
Computed by PubChem (NCBI)