Products 176249-81-3

CAS 176249-81-3 is the registry number for BOC-dl-Ala-NH-nBu, 96%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 1g.

Structural formula: {0} (CAS {1})

Tert-butyl N-[1-(butylamino)-1-oxopropan-2-yl]carbamate (CAS 176249-81-3) is a chemical compound with the molecular formula C12H24N2O3 and a molecular weight of 244.33 g/mol. IUPAC name: tert-butyl N-[1-(butylamino)-1-oxopropan-2-yl]carbamate. InChIKey: KPAZHKSDTYCANB-UHFFFAOYSA-N.

Identity
Molecular formulaC12H24N2O3
Molecular weight244.33 g/mol
IUPAC nametert-butyl N-[1-(butylamino)-1-oxopropan-2-yl]carbamate
InChIKeyKPAZHKSDTYCANB-UHFFFAOYSA-N
SMILESCCCCNC(=O)C(C)NC(=O)OC(C)(C)C

Computed by PubChem (NCBI)