CAS 42537-99-5 appears in our catalog under these names: H–Ile–Ile–OH, H-Ile-ile-oh, 95%, H-Ile-ile-oh, Ile-Ile-OH, H-Ile-Ile-OH 98%. Offered by: GLPBio, Combi-blocks, TRC, Biosynth, Ambeed. Available pack sizes: 5g, 250mg, 1g, 500mg, 100mg.
Ile-Ile is a dipeptide formed from two L-isoleucine residues. It has a role as a Mycoplasma genitalium metabolite and a human metabolite. It is functionally related to a L-isoleucine.
Source: ChEBI
| Molecular formula | C12H24N2O3 |
|---|---|
| Molecular weight | 244.33 g/mol |
| IUPAC name | (2S,3S)-2-[[(2S,3S)-2-amino-3-methylpentanoyl]amino]-3-methylpentanoic acid |
| InChIKey | BCVIOZZGJNOEQS-XKNYDFJKSA-N |
| SMILES | CC[C@H](C)[C@@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)O)N |
Computed by PubChem (NCBI)