cas: 324028-27-5 — see every product listed under this CAS number, including other names
(S)-2-((tert-Butoxycarbonyl)amino)-3-(2,4,5-trifluorophenyl)propanoic acid, 98% (CAS 324028-27-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F241442-250MG |
| cas | 324028-27-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 159.34 Pln | |
| Fluorochem | 1g | 346.77 Pln | |
| Fluorochem | 5g | 1013.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(2,4,5-trifluorophenyl)propanoic acid (CAS 324028-27-5) is a chemical compound with the molecular formula C14H16F3NO4 and a molecular weight of 319.28 g/mol. IUPAC name: (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(2,4,5-trifluorophenyl)propanoic acid. InChIKey: FTWHJNNFVISGNQ-NSHDSACASA-N.
| Molecular formula | C14H16F3NO4 |
|---|---|
| Molecular weight | 319.28 g/mol |
| IUPAC name | (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(2,4,5-trifluorophenyl)propanoic acid |
| InChIKey | FTWHJNNFVISGNQ-NSHDSACASA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC1=CC(=C(C=C1F)F)F)C(=O)O |
Computed by PubChem (NCBI)