(S)-2-(1-Aminoethyl)-5-bromophenol hydrochloride, 95% HPLC
cas: 2751603-33-3 — see every product listed under this CAS number, including other names
(S)-2-(1-Aminoethyl)-5-bromophenol hydrochloride, 95% HPLC (CAS 2751603-33-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A1538990-250mg |
| cas | 2751603-33-3 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 1766.56 Pln | |
| Ambeed | 1g | 4653.50 Pln | |
| Ambeed | 5g | 18398.44 Pln | |
| BLDpharm | 100mg | 1147.40 Pln | |
| BLDpharm | 250mg | 1902.69 Pln | |
| BLDpharm | 1g | 5012.70 Pln | |
| BLDpharm | 5g | 19835.26 Pln | |
| Chemat | 100mg | 1043.60 Pln | |
| Chemat | 250mg | 1730.00 Pln | |
| Chemat | 1g | 4552.40 Pln | |
| Chemat | 5g | 18026.00 Pln | |
| Fluorochem | 100mg | 1929.55 Pln | |
| Fluorochem | 250mg | 3225.97 Pln |
properties
| purity | 95% HPLC |
|---|---|
| delivery time | 2-3 weeks |
2-[(1S)-1-aminoethyl]-5-bromophenol;hydrochloride (CAS 2751603-33-3) is a chemical compound with the molecular formula C8H11BrClNO and a molecular weight of 252.53 g/mol. IUPAC name: 2-[(1S)-1-aminoethyl]-5-bromophenol;hydrochloride. InChIKey: ZOWFHKMYUQCATM-JEDNCBNOSA-N.
| Molecular formula | C8H11BrClNO |
|---|---|
| Molecular weight | 252.53 g/mol |
| IUPAC name | 2-[(1S)-1-aminoethyl]-5-bromophenol;hydrochloride |
| InChIKey | ZOWFHKMYUQCATM-JEDNCBNOSA-N |
| SMILES | C[C@@H](C1=C(C=C(C=C1)Br)O)N.Cl |
Computed by PubChem (NCBI)