Products 2751603-33-3
CAS 2751603-33-3 appears in our catalog under these names: (S)-2-(1-Aminoethyl)-5-bromophenol hydrochloride, 95% HPLC, 95% HPLC, (S)-2-(1-Aminoethyl)-5-bromophenol hydrochloride, 95% HPLC. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
2-[(1S)-1-aminoethyl]-5-bromophenol;hydrochloride (CAS 2751603-33-3) is a chemical compound with the molecular formula C8H11BrClNO and a molecular weight of 252.53 g/mol. IUPAC name: 2-[(1S)-1-aminoethyl]-5-bromophenol;hydrochloride. InChIKey: ZOWFHKMYUQCATM-JEDNCBNOSA-N.
| Molecular formula | C8H11BrClNO |
|---|---|
| Molecular weight | 252.53 g/mol |
| IUPAC name | 2-[(1S)-1-aminoethyl]-5-bromophenol;hydrochloride |
| InChIKey | ZOWFHKMYUQCATM-JEDNCBNOSA-N |
| SMILES | C[C@@H](C1=C(C=C(C=C1)Br)O)N.Cl |
Computed by PubChem (NCBI)