cas: 32991-17-6 — see every product listed under this CAS number, including other names
(S)-2-(2-((tert-Butoxycarbonyl)amino)-4-methylpentanamido)acetic acid, 95% (CAS 32991-17-6) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F093356-5G |
| cas | 32991-17-6 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 232.23 Pln | |
| Fluorochem | 10g | 346.77 Pln | |
| Fluorochem | 25g | 778.91 Pln | |
| Fluorochem | 100g | 2012.85 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
2-[[(2S)-4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]amino]acetic acid (CAS 32991-17-6) is a chemical compound with the molecular formula C13H24N2O5 and a molecular weight of 288.34 g/mol. IUPAC name: 2-[[(2S)-4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]amino]acetic acid. InChIKey: NRXDUMDULDHIEA-VIFPVBQESA-N.
| Molecular formula | C13H24N2O5 |
|---|---|
| Molecular weight | 288.34 g/mol |
| IUPAC name | 2-[[(2S)-4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]amino]acetic acid |
| InChIKey | NRXDUMDULDHIEA-VIFPVBQESA-N |
| SMILES | CC(C)C[C@@H](C(=O)NCC(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)