CAS 2891599-28-1 appears in our catalog under these names: tert-Butyl 3,6-diazabicyclo(3.2.2)nonane-3-carboxylate carbonate, 95%, tert-Butyl 3,6-diazabicyclo[3.2.2]nonane-3-carboxylate carbonate, 97%, 97%. Offered by: AmBeed, Chemat. Available pack sizes: 1g, 100mg, 250mg, 500mg.
Tert-butyl 3,6-diazabicyclo[3.2.2]nonane-3-carboxylate;carbonic acid (CAS 2891599-28-1) is a chemical compound with the molecular formula C13H24N2O5 and a molecular weight of 288.34 g/mol. IUPAC name: tert-butyl 3,6-diazabicyclo[3.2.2]nonane-3-carboxylate;carbonic acid. InChIKey: ZPTLRYLFIJEIDX-UHFFFAOYSA-N.
| Molecular formula | C13H24N2O5 |
|---|---|
| Molecular weight | 288.34 g/mol |
| IUPAC name | tert-butyl 3,6-diazabicyclo[3.2.2]nonane-3-carboxylate;carbonic acid |
| InChIKey | ZPTLRYLFIJEIDX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2CCC(C1)NC2.C(=O)(O)O |
Computed by PubChem (NCBI)