CAS 2828438-78-2 appears in our catalog under these names: (S)-2-(Benzo[b]thiophen-2-yl)-4-isobutyl-4,5-dihydrooxazole, 95%, (S)-2-(Benzo[b]thiophen-2-yl)-4-isobutyl-4,5-dihydrooxazole, 95%, 95%. Offered by: Ambeed, Chemat. Available pack sizes: 250mg, 5g, 100mg, 1g.
(4S)-2-(1-benzothiophen-2-yl)-4-(2-methylpropyl)-4,5-dihydro-1,3-oxazole (CAS 2828438-78-2) is a chemical compound with the molecular formula C15H17NOS and a molecular weight of 259.4 g/mol. IUPAC name: (4S)-2-(1-benzothiophen-2-yl)-4-(2-methylpropyl)-4,5-dihydro-1,3-oxazole. InChIKey: HVZFWIXHCKUXTO-LBPRGKRZSA-N.
| Molecular formula | C15H17NOS |
|---|---|
| Molecular weight | 259.4 g/mol |
| IUPAC name | (4S)-2-(1-benzothiophen-2-yl)-4-(2-methylpropyl)-4,5-dihydro-1,3-oxazole |
| InChIKey | HVZFWIXHCKUXTO-LBPRGKRZSA-N |
| SMILES | CC(C)C[C@H]1COC(=N1)C2=CC3=CC=CC=C3S2 |
Computed by PubChem (NCBI)