cas: 160801-72-9 — see every product listed under this CAS number, including other names
(S)-2-(Boc-amino)-N-methoxy-N-methylbutyramide, >95%, >95% (CAS 160801-72-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112VDK-100mg |
| cas | 160801-72-9 |
| size | 100mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 400.40 Pln | |
| Chemat | 250mg | 501.20 Pln | |
| Chemat | 1g | 1163.60 Pln | |
| Chemat | 5g | 3155.60 Pln |
| purity | >95% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl N-[(2S)-1-[methoxy(methyl)amino]-1-oxobutan-2-yl]carbamate (CAS 160801-72-9) is a chemical compound with the molecular formula C11H22N2O4 and a molecular weight of 246.30 g/mol. IUPAC name: tert-butyl N-[(2S)-1-[methoxy(methyl)amino]-1-oxobutan-2-yl]carbamate. InChIKey: UETSWVCUPQBUGT-QMMMGPOBSA-N.
| Molecular formula | C11H22N2O4 |
|---|---|
| Molecular weight | 246.30 g/mol |
| IUPAC name | tert-butyl N-[(2S)-1-[methoxy(methyl)amino]-1-oxobutan-2-yl]carbamate |
| InChIKey | UETSWVCUPQBUGT-QMMMGPOBSA-N |
| SMILES | CC[C@@H](C(=O)N(C)OC)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)