CAS 72648-80-7 appears in our catalog under these names: N-[2-(tert-Butoxycarbonylamino)ethyl]glycine ethyl ester, 95%, N–(2–(tert–Butoxycarbonylamino)ethyl)glycine Ethyl Ester, N-[2-(tert-Butoxycarbonylamino)ethyl]glycine Ethyl Ester, >95.0%(GC)(T), Boc-Aeg-OEt 98%, Ethyl 2-((2-((tert-butoxycarbonyl)amino)ethyl)amino)acetate, 98%, 98%. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 1g, 5g, 200mg, 250mg, 25g, 100mg, 10g, 100g.
Ethyl 2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]acetate (CAS 72648-80-7) is a chemical compound with the molecular formula C11H22N2O4 and a molecular weight of 246.30 g/mol. IUPAC name: ethyl 2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]acetate. InChIKey: WVFXXOLKYIPCAX-UHFFFAOYSA-N.
| Molecular formula | C11H22N2O4 |
|---|---|
| Molecular weight | 246.30 g/mol |
| IUPAC name | ethyl 2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]acetate |
| InChIKey | WVFXXOLKYIPCAX-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CNCCNC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)