CAS 1093198-33-4 appears in our catalog under these names: (R)-Methyl 2-amino-3-(tert-butoxycarbonylamino)-3-methylbutanoate, 95%, (R)–Methyl 2–amino–3–((tert–butoxycarbonyl)amino)–3–methylbutanoate. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 5g, 25g, 100mg.
Methyl (2R)-2-amino-3-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate (CAS 1093198-33-4) is a chemical compound with the molecular formula C11H22N2O4 and a molecular weight of 246.30 g/mol. IUPAC name: methyl (2R)-2-amino-3-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate. InChIKey: UTWVEOUYCGZORL-ZETCQYMHSA-N.
| Molecular formula | C11H22N2O4 |
|---|---|
| Molecular weight | 246.30 g/mol |
| IUPAC name | methyl (2R)-2-amino-3-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
| InChIKey | UTWVEOUYCGZORL-ZETCQYMHSA-N |
| SMILES | CC(C)(C)OC(=O)NC(C)(C)[C@H](C(=O)OC)N |
Computed by PubChem (NCBI)