CAS 181518-87-6 appears in our catalog under these names: (S)-2-((tert-Butoxycarbonyl)amino)-4-(dimethylamino)butanoic acid, 95%, (S)–2–((tert–Butoxycarbonyl)amino)–4–(dimethylamino)butanoic acid, H-Dab(Me2)-OH 95%, (S)-2-(tert-butoxycarbonylamino)-4-(dimethylamino)butanoic acid, 95%, 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat. Available pack sizes: 250mg, 1g, 50mg, 5g, 10g, 100mg.
(2S)-4-(dimethylamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid (CAS 181518-87-6) is a chemical compound with the molecular formula C11H22N2O4 and a molecular weight of 246.30 g/mol. IUPAC name: (2S)-4-(dimethylamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid. InChIKey: YEKMUOMXRLSQDM-QMMMGPOBSA-N.
| Molecular formula | C11H22N2O4 |
|---|---|
| Molecular weight | 246.30 g/mol |
| IUPAC name | (2S)-4-(dimethylamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
| InChIKey | YEKMUOMXRLSQDM-QMMMGPOBSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCN(C)C)C(=O)O |
Computed by PubChem (NCBI)