cas: 187475-29-2 — see every product listed under this CAS number, including other names
(S)-2-(N-Fmoc-N-methylamino)-2-cyclopentylacetic acid, 98%, 98% (CAS 187475-29-2) is a chemical reagent available from Chemat. Available pack sizes: 25g, 50g, 100g, 250g, 100mg, 250mg, 500mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12JMIC-25g |
| cas | 187475-29-2 |
| size | 25g |
| availability | 250g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 25g | 2128.40 Pln | |
| Chemat | 50g | 3923.60 Pln | |
| Chemat | 100g | 6952.40 Pln | |
| Chemat | 250g | 14819.60 Pln | |
| Chemat | 100mg | 131.60 Pln | |
| Chemat | 250mg | 165.20 Pln | |
| Chemat | 500mg | 227.60 Pln | |
| Chemat | 1g | 270.80 Pln | |
| Chemat | 5g | 683.60 Pln | |
| Chemat | 10g | 1096.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2S)-2-cyclopentyl-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]acetic acid (CAS 187475-29-2) is a chemical compound with the molecular formula C23H25NO4 and a molecular weight of 379.4 g/mol. IUPAC name: (2S)-2-cyclopentyl-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]acetic acid. InChIKey: WOAPUHMPKSQFJV-NRFANRHFSA-N.
| Molecular formula | C23H25NO4 |
|---|---|
| Molecular weight | 379.4 g/mol |
| IUPAC name | (2S)-2-cyclopentyl-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]acetic acid |
| InChIKey | WOAPUHMPKSQFJV-NRFANRHFSA-N |
| SMILES | CN([C@@H](C1CCCC1)C(=O)O)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)