cas: 2097073-17-9 — see every product listed under this CAS number, including other names
(S)-2-(Pyrrolidin-2-yl)pyridine dihydrochloride 95% (CAS 2097073-17-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A828514-100mg |
| cas | 2097073-17-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 381.50 Pln | |
| Ambeed | 250mg | 687.44 Pln | |
| Ambeed | 1g | 2217.12 Pln | |
| Ambeed | 5g | 5760.44 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A828514 |
2-[(2S)-pyrrolidin-2-yl]pyridine;dihydrochloride (CAS 2097073-17-9) is a chemical compound with the molecular formula C9H14Cl2N2 and a molecular weight of 221.12 g/mol. IUPAC name: 2-[(2S)-pyrrolidin-2-yl]pyridine;dihydrochloride. InChIKey: LPEKHJMFAUWFGV-WWPIYYJJSA-N.
| Molecular formula | C9H14Cl2N2 |
|---|---|
| Molecular weight | 221.12 g/mol |
| IUPAC name | 2-[(2S)-pyrrolidin-2-yl]pyridine;dihydrochloride |
| InChIKey | LPEKHJMFAUWFGV-WWPIYYJJSA-N |
| SMILES | C1C[C@H](NC1)C2=CC=CC=N2.Cl.Cl |
Computed by PubChem (NCBI)