CAS 2097073-17-9 appears in our catalog under these names: (S)-2-(Pyrrolidin-2-yl)pyridine dihydrochloride, 95%, (S)-2-(Pyrrolidin-2-yl)pyridine dihydrochloride, 95%, 95%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 100mg, 5g.
2-[(2S)-pyrrolidin-2-yl]pyridine;dihydrochloride (CAS 2097073-17-9) is a chemical compound with the molecular formula C9H14Cl2N2 and a molecular weight of 221.12 g/mol. IUPAC name: 2-[(2S)-pyrrolidin-2-yl]pyridine;dihydrochloride. InChIKey: LPEKHJMFAUWFGV-WWPIYYJJSA-N.
| Molecular formula | C9H14Cl2N2 |
|---|---|
| Molecular weight | 221.12 g/mol |
| IUPAC name | 2-[(2S)-pyrrolidin-2-yl]pyridine;dihydrochloride |
| InChIKey | LPEKHJMFAUWFGV-WWPIYYJJSA-N |
| SMILES | C1C[C@H](NC1)C2=CC=CC=N2.Cl.Cl |
Computed by PubChem (NCBI)