cas: 37439-99-9 — see every product listed under this CAS number, including other names
(S)-2-Acetamido-3-(naphthalen-2-yl)propanoic acid, 98% (CAS 37439-99-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F684435-1G |
| cas | 37439-99-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 174.96 Pln | |
| Fluorochem | 5g | 393.63 Pln | |
| Fluorochem | 25g | 1127.75 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
(2S)-2-acetamido-3-naphthalen-2-ylpropanoic acid (CAS 37439-99-9) is a chemical compound with the molecular formula C15H15NO3 and a molecular weight of 257.28 g/mol. IUPAC name: (2S)-2-acetamido-3-naphthalen-2-ylpropanoic acid. InChIKey: HGTIILKZSFKZMS-AWEZNQCLSA-N.
| Molecular formula | C15H15NO3 |
|---|---|
| Molecular weight | 257.28 g/mol |
| IUPAC name | (2S)-2-acetamido-3-naphthalen-2-ylpropanoic acid |
| InChIKey | HGTIILKZSFKZMS-AWEZNQCLSA-N |
| SMILES | CC(=O)N[C@@H](CC1=CC2=CC=CC=C2C=C1)C(=O)O |
Computed by PubChem (NCBI)