CAS 99642-17-8 is the registry number for (3-Aminophenyl)(3,4-dimethoxyphenyl)methanone, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g, 250mg.
(3-aminophenyl)-(3,4-dimethoxyphenyl)methanone (CAS 99642-17-8) is a chemical compound with the molecular formula C15H15NO3 and a molecular weight of 257.28 g/mol. IUPAC name: (3-aminophenyl)-(3,4-dimethoxyphenyl)methanone. InChIKey: HFZPYPRRAVDPBX-UHFFFAOYSA-N.
| Molecular formula | C15H15NO3 |
|---|---|
| Molecular weight | 257.28 g/mol |
| IUPAC name | (3-aminophenyl)-(3,4-dimethoxyphenyl)methanone |
| InChIKey | HFZPYPRRAVDPBX-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C(=O)C2=CC(=CC=C2)N)OC |
Computed by PubChem (NCBI)