CAS 409353-61-3 appears in our catalog under these names: 3-(3-Formyl-2,5-dimethyl-1H-pyrrol-1-yl)-2-methylbenzoic acid, 3-(3-Formyl-2,5-dimethyl-1h-pyrrol-1-yl)-2-methylbenzoic acid, 95%, 3-(3-Formyl-2,5-dimethyl-1H-pyrrol-1-yl)-2-methylbenzoic acid, 97%. Offered by: Biosynth, Combi-blocks, AmBeed. Available pack sizes: 5g, 0,5g, 250mg, 10g, 1g.
3-(3-formyl-2,5-dimethylpyrrol-1-yl)-2-methylbenzoic acid (CAS 409353-61-3) is a chemical compound with the molecular formula C15H15NO3 and a molecular weight of 257.28 g/mol. IUPAC name: 3-(3-formyl-2,5-dimethylpyrrol-1-yl)-2-methylbenzoic acid. InChIKey: LQCHZVZBSQAVDA-UHFFFAOYSA-N.
| Molecular formula | C15H15NO3 |
|---|---|
| Molecular weight | 257.28 g/mol |
| IUPAC name | 3-(3-formyl-2,5-dimethylpyrrol-1-yl)-2-methylbenzoic acid |
| InChIKey | LQCHZVZBSQAVDA-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(N1C2=CC=CC(=C2C)C(=O)O)C)C=O |
Computed by PubChem (NCBI)