CAS 37439-99-9 appears in our catalog under these names: (S)-N-Acetyl-2-naphthylalanine, 95%, (S)–2–Acetamido–3–(naphthalen–2–yl)propanoic acid, Ac-2-Nal-OH, 98%, 98%, Ac-2-Nal-OH, 99.95%, (S)-2-Acetamido-3-(naphthalen-2-yl)propanoic acid, 98%. Offered by: Combi-blocks, GLPBio, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 5g, 1g, 25g, 100mg, 5 g, 10 g, 1 g.
(2S)-2-acetamido-3-naphthalen-2-ylpropanoic acid (CAS 37439-99-9) is a chemical compound with the molecular formula C15H15NO3 and a molecular weight of 257.28 g/mol. IUPAC name: (2S)-2-acetamido-3-naphthalen-2-ylpropanoic acid. InChIKey: HGTIILKZSFKZMS-AWEZNQCLSA-N.
| Molecular formula | C15H15NO3 |
|---|---|
| Molecular weight | 257.28 g/mol |
| IUPAC name | (2S)-2-acetamido-3-naphthalen-2-ylpropanoic acid |
| InChIKey | HGTIILKZSFKZMS-AWEZNQCLSA-N |
| SMILES | CC(=O)N[C@@H](CC1=CC2=CC=CC=C2C=C1)C(=O)O |
Computed by PubChem (NCBI)