cas: 23500-04-1 — see every product listed under this CAS number, including other names
(S)-2-Acetamido-6-((tert-butoxycarbonyl)amino)hexanoic acid, 95% (CAS 23500-04-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F212887-1G |
| cas | 23500-04-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 102.07 Pln | |
| Fluorochem | 5g | 107.27 Pln | |
| Fluorochem | 10g | 143.72 Pln | |
| Fluorochem | 25g | 195.78 Pln | |
| Fluorochem | 100g | 601.89 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
(2S)-2-acetamido-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid (CAS 23500-04-1) is a chemical compound with the molecular formula C13H24N2O5 and a molecular weight of 288.34 g/mol. IUPAC name: (2S)-2-acetamido-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid. InChIKey: NZAMQYCOJSWUAO-JTQLQIEISA-N.
| Molecular formula | C13H24N2O5 |
|---|---|
| Molecular weight | 288.34 g/mol |
| IUPAC name | (2S)-2-acetamido-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid |
| InChIKey | NZAMQYCOJSWUAO-JTQLQIEISA-N |
| SMILES | CC(=O)N[C@@H](CCCCNC(=O)OC(C)(C)C)C(=O)O |
Computed by PubChem (NCBI)