(S)-2-Amino-2-(4-bromophenyl)ethanol hydrochloride, 98%, 98%
cas: 2095773-02-5 — see every product listed under this CAS number, including other names
(S)-2-Amino-2-(4-bromophenyl)ethanol hydrochloride, 98%, 98% (CAS 2095773-02-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12DU6W-100mg |
| cas | 2095773-02-5 |
| size | 100mg |
| availability | 100g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 117.20 Pln | |
| Chemat | 250mg | 184.40 Pln | |
| Chemat | 500mg | 266.00 Pln | |
| Chemat | 1g | 362.00 Pln | |
| Chemat | 5g | 971.60 Pln | |
| Chemat | 10g | 1571.60 Pln | |
| Chemat | 25g | 3078.80 Pln | |
| Chemat | 100g | 7907.60 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2S)-2-amino-2-(4-bromophenyl)ethanol;hydrochloride (CAS 2095773-02-5) is a chemical compound with the molecular formula C8H11BrClNO and a molecular weight of 252.53 g/mol. IUPAC name: (2S)-2-amino-2-(4-bromophenyl)ethanol;hydrochloride. InChIKey: PQQGURGSEYFRCS-DDWIOCJRSA-N.
| Molecular formula | C8H11BrClNO |
|---|---|
| Molecular weight | 252.53 g/mol |
| IUPAC name | (2S)-2-amino-2-(4-bromophenyl)ethanol;hydrochloride |
| InChIKey | PQQGURGSEYFRCS-DDWIOCJRSA-N |
| SMILES | C1=CC(=CC=C1[C@@H](CO)N)Br.Cl |
Computed by PubChem (NCBI)
Synonyms:
(2S)-2-amino-2-(4-bromophenyl)ethan-1-ol hydrochloride, (S)-2-Amino-2-(4-bromophenyl)ethanol hydrochloride, (2S)-2-AMINO-2-(4-BROMOPHENYL)ETHAN-1-OL HCl, (S)-2-Amino-2-(4-bromophenyl)ethan-1-ol hydrochloride, (2S)-2-amino-2-(4-bromophenyl)ethanol;hydrochloride, (S)-2-Amino-2-(4-bromophenyl)ethanol HCl, (S)-2-Amino-2-(4-bromophenyl)ethan-1-ol hydrochloride - [A91746]