(S)-2-Amino-2-(4-iodophenyl)ethan-1-ol hydrochloride, 95%
cas: 2376106-42-0 — see every product listed under this CAS number, including other names
(S)-2-Amino-2-(4-iodophenyl)ethan-1-ol hydrochloride, 95% (CAS 2376106-42-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 50mg, 100mg. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A994001-250mg |
| cas | 2376106-42-0 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 926.62 Pln | |
| Ambeed | 1g | 2222.69 Pln | |
| Ambeed | 5g | 7612.75 Pln | |
| BLDpharm | 50mg | 614.25 Pln | |
| BLDpharm | 100mg | 775.31 Pln | |
| BLDpharm | 250mg | 991.90 Pln | |
| BLDpharm | 1g | 2391.40 Pln | |
| BLDpharm | 5g | 8200.47 Pln | |
| Chemat | 50mg | 165.20 Pln | |
| Chemat | 100mg | 213.20 Pln | |
| Chemat | 250mg | 419.60 Pln | |
| Chemat | 1g | 1466.00 Pln | |
| Chemat | 5g | 4974.80 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
(2S)-2-amino-2-(4-iodophenyl)ethanol;hydrochloride (CAS 2376106-42-0) is a chemical compound with the molecular formula C8H11ClINO and a molecular weight of 299.53 g/mol. IUPAC name: (2S)-2-amino-2-(4-iodophenyl)ethanol;hydrochloride. InChIKey: FXOQGXRQHSKXRI-DDWIOCJRSA-N.
| Molecular formula | C8H11ClINO |
|---|---|
| Molecular weight | 299.53 g/mol |
| IUPAC name | (2S)-2-amino-2-(4-iodophenyl)ethanol;hydrochloride |
| InChIKey | FXOQGXRQHSKXRI-DDWIOCJRSA-N |
| SMILES | C1=CC(=CC=C1[C@@H](CO)N)I.Cl |
Computed by PubChem (NCBI)
Synonyms:
(S)-2-Amino-2-(4-iodophenyl)ethan-1-ol hydrochloride, (2S)-2-Amino-2-(4-iodophenyl)ethan-1-ol HCl, (S)-2-Amino-2-(4-iodophenyl)ethan-1-olhydrochloride, (2S)-2-amino-2-(4-iodophenyl)ethan-1-ol hydrochloride, (2S)-2-amino-2-(4-iodophenyl)ethanol;hydrochloride, (S)-2-amino-2-(4-iodophenyl)ethanol hydrochloride